C19H19N3O4 — CID 143333199
4-butyl-5-(4-cyanophenyl)-N-formyl-2-(methylamino)-6-oxopyran-3-carboxamide (PubChem CID 143333199) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is 4-butyl-5-(4-cyanophenyl)-N-formyl-2-(methylamino)-6-oxopyran-3-carboxamide.
| Compound Name | 4-butyl-5-(4-cyanophenyl)-N-formyl-2-(methylamino)-6-oxopyran-3-carboxamide |
|---|---|
| PubChem CID | 143333199 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 4-butyl-5-(4-cyanophenyl)-N-formyl-2-(methylamino)-6-oxopyran-3-carboxamide |
| SMILES | CCCCc1c(C(=O)NC=O)c(NC)oc(=O)c1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H19N3O4/c1-3-4-5-14-15(13-8-6-12(10-20)7-9-13)19(25)26-18(21-2)16(14)17(24)22-11-23/h6-9,11,21H,3-5H2,1-2H3,(H,22,23,24) |
| InChIKey | PCACPSXPDWAWDQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|