C22H32N2O4 — CID 143333145
4-butyl-N-formyl-2-(methylamino)-6-oxo-5-phenylpyran-3-carboxamide;ethane (PubChem CID 143333145) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is 4-butyl-N-formyl-2-(methylamino)-6-oxo-5-phenylpyran-3-carboxamide;ethane.
| Compound Name | 4-butyl-N-formyl-2-(methylamino)-6-oxo-5-phenylpyran-3-carboxamide;ethane |
|---|---|
| PubChem CID | 143333145 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 4-butyl-N-formyl-2-(methylamino)-6-oxo-5-phenylpyran-3-carboxamide;ethane |
| SMILES | CC.CC.CCCCc1c(C(=O)NC=O)c(NC)oc(=O)c1-c1ccccc1 |
| InChI | InChI=1S/C18H20N2O4.2C2H6/c1-3-4-10-13-14(12-8-6-5-7-9-12)18(23)24-17(19-2)15(13)16(22)20-11-21;2*1-2/h5-9,11,19H,3-4,10H2,1-2H3,(H,20,21,22);2*1-2H3 |
| InChIKey | GMTNIMNIXFUHRX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|