C18H17N3O6 — CID 59304550
benzyl N-[3-(2,4,7-trioxo-1H-pyrano[2,3-d]pyrimidin-5-yl)propyl]carbamate (PubChem CID 59304550) has the molecular formula C18H17N3O6 and a molecular weight of 371.35 g/mol. Its IUPAC name is benzyl N-[3-(2,4,7-trioxo-1H-pyrano[2,3-d]pyrimidin-5-yl)propyl]carbamate.
| Compound Name | benzyl N-[3-(2,4,7-trioxo-1H-pyrano[2,3-d]pyrimidin-5-yl)propyl]carbamate |
|---|---|
| PubChem CID | 59304550 |
| Molecular Formula | C18H17N3O6 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | benzyl N-[3-(2,4,7-trioxo-1H-pyrano[2,3-d]pyrimidin-5-yl)propyl]carbamate |
| SMILES | O=C(NCCCc1cc(=O)oc2[nH]c(=O)[nH]c(=O)c12)OCc1ccccc1 |
| InChI | InChI=1S/C18H17N3O6/c22-13-9-12(14-15(23)20-17(24)21-16(14)27-13)7-4-8-19-18(25)26-10-11-5-2-1-3-6-11/h1-3,5-6,9H,4,7-8,10H2,(H,19,25)(H2,20,21,23,24) |
| InChIKey | CIIWCNSRXMOFOH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 134.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|