C16H16N2O4 — CID 6480423
[(E)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] benzoate (PubChem CID 6480423) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is [(E)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] benzoate.
| Compound Name | [(E)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] benzoate |
|---|---|
| PubChem CID | 6480423 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | [(E)-4-(5-methyl-2,4-dioxopyrimidin-1-yl)but-2-enyl] benzoate |
| SMILES | Cc1cn(C/C=C/COC(=O)c2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H16N2O4/c1-12-11-18(16(21)17-14(12)19)9-5-6-10-22-15(20)13-7-3-2-4-8-13/h2-8,11H,9-10H2,1H3,(H,17,19,21)/b6-5+ |
| InChIKey | BHBWPKZQOWJAGH-AATRIKPKSA-N |
| XLogP | 1.26 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|