C19H28 — CID 143335391
ethylidenecyclobutane;3,7,7-trimethyl-2-[(Z)-prop-1-enyl]cyclohepta-1,3,5-triene (PubChem CID 143335391) has the molecular formula C19H28 and a molecular weight of 256.43 g/mol. Its IUPAC name is ethylidenecyclobutane;3,7,7-trimethyl-2-[(Z)-prop-1-enyl]cyclohepta-1,3,5-triene.
| Compound Name | ethylidenecyclobutane;3,7,7-trimethyl-2-[(Z)-prop-1-enyl]cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 143335391 |
| Molecular Formula | C19H28 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | ethylidenecyclobutane;3,7,7-trimethyl-2-[(Z)-prop-1-enyl]cyclohepta-1,3,5-triene |
| SMILES | C/C=C\C1=CC(C)(C)C=CC=C1C.CC=C1CCC1 |
| InChI | InChI=1S/C13H18.C6H10/c1-5-7-12-10-13(3,4)9-6-8-11(12)2;1-2-6-4-3-5-6/h5-10H,1-4H3;2H,3-5H2,1H3/b7-5-; |
| InChIKey | CQYQAYAKEGNTGQ-YJOCEBFMSA-N |
| XLogP | 6.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|