C14H19N — CID 166120455
4,4,6,6-tetramethyl-1H-cyclohepta[b]pyridine (PubChem CID 166120455) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 4,4,6,6-tetramethyl-1H-cyclohepta[b]pyridine.
| Compound Name | 4,4,6,6-tetramethyl-1H-cyclohepta[b]pyridine |
|---|---|
| PubChem CID | 166120455 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 4,4,6,6-tetramethyl-1H-cyclohepta[b]pyridine |
| SMILES | CC1(C)C=CC=C2NC=CC(C)(C)C2=C1 |
| InChI | InChI=1S/C14H19N/c1-13(2)7-5-6-12-11(10-13)14(3,4)8-9-15-12/h5-10,15H,1-4H3 |
| InChIKey | HBARENOKSZVGJO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |