C11H14O2 — CID 170194792
8,8-dimethyl-4H-cyclohepta[d][1,3]dioxine (PubChem CID 170194792) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 8,8-dimethyl-4H-cyclohepta[d][1,3]dioxine.
| Compound Name | 8,8-dimethyl-4H-cyclohepta[d][1,3]dioxine |
|---|---|
| PubChem CID | 170194792 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 8,8-dimethyl-4H-cyclohepta[d][1,3]dioxine |
| SMILES | CC1(C)C=CC=C2COCOC2=C1 |
| InChI | InChI=1S/C11H14O2/c1-11(2)5-3-4-9-7-12-8-13-10(9)6-11/h3-6H,7-8H2,1-2H3 |
| InChIKey | DCIJRICIRKSQTK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |