C8H10O4 — CID 13275526
5-(4H-1,3-dioxin-5-yl)-4H-1,3-dioxine (PubChem CID 13275526) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is 5-(4H-1,3-dioxin-5-yl)-4H-1,3-dioxine.
| Compound Name | 5-(4H-1,3-dioxin-5-yl)-4H-1,3-dioxine |
|---|---|
| PubChem CID | 13275526 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 5-(4H-1,3-dioxin-5-yl)-4H-1,3-dioxine |
| SMILES | C1=C(C2=COCOC2)COCO1 |
| InChI | InChI=1S/C8H10O4/c1-7(2-10-5-9-1)8-3-11-6-12-4-8/h1,3H,2,4-6H2 |
| InChIKey | LWHGMTJTHROFIQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |