C9H12O4 — CID 102474298
5-(1,3-dioxan-5-ylidenemethylidene)-1,3-dioxane (PubChem CID 102474298) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is 5-(1,3-dioxan-5-ylidenemethylidene)-1,3-dioxane.
| Compound Name | 5-(1,3-dioxan-5-ylidenemethylidene)-1,3-dioxane |
|---|---|
| PubChem CID | 102474298 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 5-(1,3-dioxan-5-ylidenemethylidene)-1,3-dioxane |
| SMILES | C(=C1COCOC1)=C1COCOC1 |
| InChI | InChI=1S/C9H12O4/c1(8-2-10-6-11-3-8)9-4-12-7-13-5-9/h2-7H2 |
| InChIKey | HNWCGNJFNCXHOQ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |