C5H8O4 — CID 24977583
6-hydroxy-1,3-dioxepan-5-one (PubChem CID 24977583) has the molecular formula C5H8O4 and a molecular weight of 132.11 g/mol. Its IUPAC name is 6-hydroxy-1,3-dioxepan-5-one.
| Compound Name | 6-hydroxy-1,3-dioxepan-5-one |
|---|---|
| PubChem CID | 24977583 |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 132.11 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | 6-hydroxy-1,3-dioxepan-5-one |
| SMILES | O=C1COCOCC1O |
| InChI | InChI=1S/C5H8O4/c6-4-1-8-3-9-2-5(4)7/h4,6H,1-3H2 |
| InChIKey | IZTYIMFCTYOOOW-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.11 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |