C4H6O4 — CID 174900743
4,5-dihydroxyoxolan-3-one (PubChem CID 174900743) has the molecular formula C4H6O4 and a molecular weight of 118.09 g/mol. Its IUPAC name is 4,5-dihydroxyoxolan-3-one.
| Compound Name | 4,5-dihydroxyoxolan-3-one |
|---|---|
| PubChem CID | 174900743 |
| Molecular Formula | C4H6O4 |
| Molecular Weight | 118.09 g/mol |
| Exact Mass | 118.03 |
| IUPAC Name | 4,5-dihydroxyoxolan-3-one |
| SMILES | O=C1COC(O)C1O |
| InChI | InChI=1S/C4H6O4/c5-2-1-8-4(7)3(2)6/h3-4,6-7H,1H2 |
| InChIKey | GQNMZHWDPARHJH-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.09 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |