C9H14O6 — CID 59906311
[(3R,4S)-3,4-dihydroxy-5-oxooxan-2-yl]methyl propanoate (PubChem CID 59906311) has the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. Its IUPAC name is [(3R,4S)-3,4-dihydroxy-5-oxooxan-2-yl]methyl propanoate.
| Compound Name | [(3R,4S)-3,4-dihydroxy-5-oxooxan-2-yl]methyl propanoate |
|---|---|
| PubChem CID | 59906311 |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | [(3R,4S)-3,4-dihydroxy-5-oxooxan-2-yl]methyl propanoate |
| SMILES | CCC(=O)OCC1OCC(=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H14O6/c1-2-7(11)15-4-6-9(13)8(12)5(10)3-14-6/h6,8-9,12-13H,2-4H2,1H3/t6?,8-,9+/m1/s1 |
| InChIKey | MUXPZWADUYUDGM-UOWBCLSMSA-N |
| XLogP | -1.37 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |