C11H16F2O5 — CID 156755734
(4,4-difluoro-3-propanoyloxyoxolan-2-yl)methyl propanoate (PubChem CID 156755734) has the molecular formula C11H16F2O5 and a molecular weight of 266.24 g/mol. Its IUPAC name is (4,4-difluoro-3-propanoyloxyoxolan-2-yl)methyl propanoate.
| Compound Name | (4,4-difluoro-3-propanoyloxyoxolan-2-yl)methyl propanoate |
|---|---|
| PubChem CID | 156755734 |
| Molecular Formula | C11H16F2O5 |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | (4,4-difluoro-3-propanoyloxyoxolan-2-yl)methyl propanoate |
| SMILES | CCC(=O)OCC1OCC(F)(F)C1OC(=O)CC |
| InChI | InChI=1S/C11H16F2O5/c1-3-8(14)16-5-7-10(18-9(15)4-2)11(12,13)6-17-7/h7,10H,3-6H2,1-2H3 |
| InChIKey | JLLJBDMFJFVYLF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |