C10H13NOS — CID 143335363
6,6-dimethyl-3,4-dihydrocyclohepta[c][1,2,5]oxathiazine (PubChem CID 143335363) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is 6,6-dimethyl-3,4-dihydrocyclohepta[c][1,2,5]oxathiazine.
| Compound Name | 6,6-dimethyl-3,4-dihydrocyclohepta[c][1,2,5]oxathiazine |
|---|---|
| PubChem CID | 143335363 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 6,6-dimethyl-3,4-dihydrocyclohepta[c][1,2,5]oxathiazine |
| SMILES | CC1(C)C=CC=C2SOCNC2=C1 |
| InChI | InChI=1S/C10H13NOS/c1-10(2)5-3-4-9-8(6-10)11-7-12-13-9/h3-6,11H,7H2,1-2H3 |
| InChIKey | KVTWSKYXWDCQIX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|