C11H14 — CID 59289880
1,4-bis[(E)-prop-1-enyl]cyclopenta-1,3-diene (PubChem CID 59289880) has the molecular formula C11H14 and a molecular weight of 146.23 g/mol. Its IUPAC name is 1,4-bis[(E)-prop-1-enyl]cyclopenta-1,3-diene.
| Compound Name | 1,4-bis[(E)-prop-1-enyl]cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 59289880 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 1,4-bis[(E)-prop-1-enyl]cyclopenta-1,3-diene |
| SMILES | C/C=C/C1=CC=C(/C=C/C)C1 |
| InChI | InChI=1S/C11H14/c1-3-5-10-7-8-11(9-10)6-4-2/h3-8H,9H2,1-2H3/b5-3+,6-4+ |
| InChIKey | UUQJFRHPAHFFPW-GGWOSOGESA-N |
| XLogP | 3.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |