C15H19N — CID 171596789
1-[(3E)-penta-1,3-dien-3-yl]-2,5-bis[(Z)-prop-1-enyl]pyrrole (PubChem CID 171596789) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 1-[(3E)-penta-1,3-dien-3-yl]-2,5-bis[(Z)-prop-1-enyl]pyrrole.
| Compound Name | 1-[(3E)-penta-1,3-dien-3-yl]-2,5-bis[(Z)-prop-1-enyl]pyrrole |
|---|---|
| PubChem CID | 171596789 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 1-[(3E)-penta-1,3-dien-3-yl]-2,5-bis[(Z)-prop-1-enyl]pyrrole |
| SMILES | C=C/C(=C\C)n1c(/C=C\C)ccc1/C=C\C |
| InChI | InChI=1S/C15H19N/c1-5-9-14-11-12-15(10-6-2)16(14)13(7-3)8-4/h5-12H,3H2,1-2,4H3/b9-5-,10-6-,13-8+ |
| InChIKey | JKTZQQDUDCNIGQ-TWYALZNUSA-N |
| XLogP | 4.60 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|