C13H15N — CID 134505198
1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2,5-dimethylidenepyrrole (PubChem CID 134505198) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is 1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2,5-dimethylidenepyrrole.
| Compound Name | 1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2,5-dimethylidenepyrrole |
|---|---|
| PubChem CID | 134505198 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2,5-dimethylidenepyrrole |
| SMILES | C=C/C=C\C(=C/C)n1c(=C)ccc1=C |
| InChI | InChI=1S/C13H15N/c1-5-7-8-13(6-2)14-11(3)9-10-12(14)4/h5-10H,1,3-4H2,2H3/b8-7-,13-6+ |
| InChIKey | MXFJZBHSWUFXAN-ZUKYEBQOSA-N |
| XLogP | 1.91 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|