About 2-deuteriobut-2-ene;2-deuterio-3-ethylidene-1-prop-1-enylcyclohexene
2-deuteriobut-2-ene;2-deuterio-3-ethylidene-1-prop-1-enylcyclohexene (PubChem CID 91338520) has the molecular formula C15H24
and a molecular weight of 206.37 g/mol. Its IUPAC name is 2-deuteriobut-2-ene;2-deuterio-3-ethylidene-1-prop-1-enylcyclohexene.
Molecular Properties
| Compound Name | 2-deuteriobut-2-ene;2-deuterio-3-ethylidene-1-prop-1-enylcyclohexene |
| PubChem CID | 91338520 |
| Molecular Formula | C15H24 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | 2-deuteriobut-2-ene;2-deuterio-3-ethylidene-1-prop-1-enylcyclohexene |
| SMILES | [2H]C(C)=CC.[2H]C1=C(C=CC)CCCC1=CC |
| InChI | InChI=1S/C11H16.C4H8/c1-3-6-11-8-5-7-10(4-2)9-11;1-3-4-2/h3-4,6,9H,5,7-8H2,1-2H3;3-4H,1-2H3/i9D;3D |
| InChIKey | KGEZRZJBMQHBAL-DFACZYSZSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-deuteriobut-2-ene;2-deuterio-3-ethylidene-1-prop-1-enylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-deuteriobut-2-ene;2-deuterio-3-ethylidene-1-prop-1-enylcyclohexene?
The IUPAC name of 2-deuteriobut-2-ene;2-deuterio-3-ethylidene-1-prop-1-enylcyclohexene (CID 91338520) is 2-deuteriobut-2-ene;2-deuterio-3-ethylidene-1-prop-1-enylcyclohexene.
What is the SMILES notation for 2-deuteriobut-2-ene;2-deuterio-3-ethylidene-1-prop-1-enylcyclohexene?
The canonical SMILES for 2-deuteriobut-2-ene;2-deuterio-3-ethylidene-1-prop-1-enylcyclohexene is [2H]C(C)=CC.[2H]C1=C(C=CC)CCCC1=CC.
What is the InChIKey of 2-deuteriobut-2-ene;2-deuterio-3-ethylidene-1-prop-1-enylcyclohexene?
The InChIKey is KGEZRZJBMQHBAL-DFACZYSZSA-N. The full InChI is InChI=1S/C11H16.C4H8/c1-3-6-11-8-5-7-10(4-2)9-11;1-3-4-2/h3-4,6,9H,5,7-8H2,1-2H3;3-4H,1-2H3/i9D;3D.
What are the key properties of 2-deuteriobut-2-ene;2-deuterio-3-ethylidene-1-prop-1-enylcyclohexene?
2-deuteriobut-2-ene;2-deuterio-3-ethylidene-1-prop-1-enylcyclohexene has a molecular weight of 206.37 g/mol, XLogP of 5.20, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-deuteriobut-2-ene;2-deuterio-3-ethylidene-1-prop-1-enylcyclohexene is sourced from PubChem (CID 91338520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).