C34H58N4O2 — CID 142858823
ethane;4-[(E)-3-oxo-3-[(2,2,6-trimethylpiperidin-4-yl)amino]prop-1-enyl]-6-[(Z)-prop-1-enyl]-N-(2,2,6-trimethylpiperidin-4-yl)cyclohepta-1,3,6-triene-1-carboxamide (PubChem CID 142858823) has the molecular formula C34H58N4O2 and a molecular weight of 554.86 g/mol. Its IUPAC name is ethane;4-[(E)-3-oxo-3-[(2,2,6-trimethylpiperidin-4-yl)amino]prop-1-enyl]-6-[(Z)-prop-1-enyl]-N-(2,2,6-trimethylpiperidin-4-yl)cyclohepta-1,3,6-triene-1-carboxamide.
| Compound Name | ethane;4-[(E)-3-oxo-3-[(2,2,6-trimethylpiperidin-4-yl)amino]prop-1-enyl]-6-[(Z)-prop-1-enyl]-N-(2,2,6-trimethylpiperidin-4-yl)cyclohepta-1,3,6-triene-1-carboxamide |
|---|---|
| PubChem CID | 142858823 |
| Molecular Formula | C34H58N4O2 |
| Molecular Weight | 554.86 g/mol |
| Exact Mass | 554.46 |
| IUPAC Name | ethane;4-[(E)-3-oxo-3-[(2,2,6-trimethylpiperidin-4-yl)amino]prop-1-enyl]-6-[(Z)-prop-1-enyl]-N-(2,2,6-trimethylpiperidin-4-yl)cyclohepta-1,3,6-triene-1-carboxamide |
| SMILES | C/C=C\C1=CC(C(=O)NC2CC(C)NC(C)(C)C2)=CC=C(/C=C/C(=O)NC2CC(C)NC(C)(C)C2)C1.CC.CC |
| InChI | InChI=1S/C30H46N4O2.2C2H6/c1-8-9-23-16-22(11-13-27(35)31-25-14-20(2)33-29(4,5)18-25)10-12-24(17-23)28(36)32-26-15-21(3)34-30(6,7)19-26;2*1-2/h8-13,17,20-21,25-26,33-34H,14-16,18-19H2,1-7H3,(H,31,35)(H,32,36);2*1-2H3/b9-8-,13-11+;; |
| InChIKey | KVEMHWMSWBDFMN-WDWGOTMXSA-N |
| XLogP | 6.42 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.86 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|