C28H50N4O2 — CID 22755875
2-(2,2,6,6-tetramethylpiperidin-4-ylidene)-N-[6-[[2-(2,2,6,6-tetramethylpiperidin-4-ylidene)acetyl]amino]hexyl]acetamide (PubChem CID 22755875) has the molecular formula C28H50N4O2 and a molecular weight of 474.73 g/mol. Its IUPAC name is 2-(2,2,6,6-tetramethylpiperidin-4-ylidene)-N-[6-[[2-(2,2,6,6-tetramethylpiperidin-4-ylidene)acetyl]amino]hexyl]acetamide.
| Compound Name | 2-(2,2,6,6-tetramethylpiperidin-4-ylidene)-N-[6-[[2-(2,2,6,6-tetramethylpiperidin-4-ylidene)acetyl]amino]hexyl]acetamide |
|---|---|
| PubChem CID | 22755875 |
| Molecular Formula | C28H50N4O2 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.39 |
| IUPAC Name | 2-(2,2,6,6-tetramethylpiperidin-4-ylidene)-N-[6-[[2-(2,2,6,6-tetramethylpiperidin-4-ylidene)acetyl]amino]hexyl]acetamide |
| SMILES | CC1(C)CC(=CC(=O)NCCCCCCNC(=O)C=C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C28H50N4O2/c1-25(2)17-21(18-26(3,4)31-25)15-23(33)29-13-11-9-10-12-14-30-24(34)16-22-19-27(5,6)32-28(7,8)20-22/h15-16,31-32H,9-14,17-20H2,1-8H3,(H,29,33)(H,30,34) |
| InChIKey | RAVRHLAJVGRJPW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|