C26H46N4O2 — CID 22755847
2-(1,2,2,6,6-pentamethylpiperidin-4-ylidene)-N-[2-[[2-(1,2,2,6,6-pentamethylpiperidin-4-ylidene)acetyl]amino]ethyl]acetamide (PubChem CID 22755847) has the molecular formula C26H46N4O2 and a molecular weight of 446.68 g/mol. Its IUPAC name is 2-(1,2,2,6,6-pentamethylpiperidin-4-ylidene)-N-[2-[[2-(1,2,2,6,6-pentamethylpiperidin-4-ylidene)acetyl]amino]ethyl]acetamide.
| Compound Name | 2-(1,2,2,6,6-pentamethylpiperidin-4-ylidene)-N-[2-[[2-(1,2,2,6,6-pentamethylpiperidin-4-ylidene)acetyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 22755847 |
| Molecular Formula | C26H46N4O2 |
| Molecular Weight | 446.68 g/mol |
| Exact Mass | 446.36 |
| IUPAC Name | 2-(1,2,2,6,6-pentamethylpiperidin-4-ylidene)-N-[2-[[2-(1,2,2,6,6-pentamethylpiperidin-4-ylidene)acetyl]amino]ethyl]acetamide |
| SMILES | CN1C(C)(C)CC(=CC(=O)NCCNC(=O)C=C2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C26H46N4O2/c1-23(2)15-19(16-24(3,4)29(23)9)13-21(31)27-11-12-28-22(32)14-20-17-25(5,6)30(10)26(7,8)18-20/h13-14H,11-12,15-18H2,1-10H3,(H,27,31)(H,28,32) |
| InChIKey | JNQBWWXXAISJMH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.68 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|