C16H28N2O — CID 22755909
N-[(E)-but-2-enyl]-2-(1,2,2,6,6-pentamethylpiperidin-4-ylidene)acetamide (PubChem CID 22755909) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-2-(1,2,2,6,6-pentamethylpiperidin-4-ylidene)acetamide.
| Compound Name | N-[(E)-but-2-enyl]-2-(1,2,2,6,6-pentamethylpiperidin-4-ylidene)acetamide |
|---|---|
| PubChem CID | 22755909 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | N-[(E)-but-2-enyl]-2-(1,2,2,6,6-pentamethylpiperidin-4-ylidene)acetamide |
| SMILES | C/C=C/CNC(=O)C=C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C16H28N2O/c1-7-8-9-17-14(19)10-13-11-15(2,3)18(6)16(4,5)12-13/h7-8,10H,9,11-12H2,1-6H3,(H,17,19)/b8-7+ |
| InChIKey | KCVLCVCVSXHYSP-BQYQJAHWSA-N |
| XLogP | 2.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|