C14H14 — CID 20782079
1-buta-1,3-dienyl-4-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene (PubChem CID 20782079) has the molecular formula C14H14 and a molecular weight of 182.27 g/mol. Its IUPAC name is 1-buta-1,3-dienyl-4-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene.
| Compound Name | 1-buta-1,3-dienyl-4-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 20782079 |
| Molecular Formula | C14H14 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1-buta-1,3-dienyl-4-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene |
| SMILES | C=CC=CC1=CC=C(C2=CC=CC2)C1 |
| InChI | InChI=1S/C14H14/c1-2-3-6-12-9-10-14(11-12)13-7-4-5-8-13/h2-7,9-10H,1,8,11H2 |
| InChIKey | YJCQDBONPICRGW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|