C12H17O3P — CID 143338462
3-[4-(ethylphosphanylmethoxy)phenyl]propanoic acid (PubChem CID 143338462) has the molecular formula C12H17O3P and a molecular weight of 240.24 g/mol. Its IUPAC name is 3-[4-(ethylphosphanylmethoxy)phenyl]propanoic acid.
| Compound Name | 3-[4-(ethylphosphanylmethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 143338462 |
| Molecular Formula | C12H17O3P |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 3-[4-(ethylphosphanylmethoxy)phenyl]propanoic acid |
| SMILES | CCPCOc1ccc(CCC(=O)O)cc1 |
| InChI | InChI=1S/C12H17O3P/c1-2-16-9-15-11-6-3-10(4-7-11)5-8-12(13)14/h3-4,6-7,16H,2,5,8-9H2,1H3,(H,13,14) |
| InChIKey | IMFUONJLGZRCOK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|