C13H18AcO4S — CID 22949876
actinium;3-[4-[2-(2-hydroxyethylsulfanyl)ethoxy]phenyl]propanoic acid (PubChem CID 22949876) has the molecular formula C13H18AcO4S and a molecular weight of 497.35 g/mol. Its IUPAC name is actinium;3-[4-[2-(2-hydroxyethylsulfanyl)ethoxy]phenyl]propanoic acid.
| Compound Name | actinium;3-[4-[2-(2-hydroxyethylsulfanyl)ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22949876 |
| Molecular Formula | C13H18AcO4S |
| Molecular Weight | 497.35 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | actinium;3-[4-[2-(2-hydroxyethylsulfanyl)ethoxy]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(OCCSCCO)cc1.[Ac] |
| InChI | InChI=1S/C13H18O4S.Ac/c14-7-9-18-10-8-17-12-4-1-11(2-5-12)3-6-13(15)16;/h1-2,4-5,14H,3,6-10H2,(H,15,16); |
| InChIKey | WHIOCJLIRBMZDG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|