C14H19N5OS — CID 143338690
[2-[(2R)-2-methylpyrrolidin-1-yl]-2-oxoethyl] N-diazenyl-N-phenylcarbamimidothioate (PubChem CID 143338690) has the molecular formula C14H19N5OS and a molecular weight of 305.41 g/mol. Its IUPAC name is [2-[(2R)-2-methylpyrrolidin-1-yl]-2-oxoethyl] N-diazenyl-N-phenylcarbamimidothioate.
| Compound Name | [2-[(2R)-2-methylpyrrolidin-1-yl]-2-oxoethyl] N-diazenyl-N-phenylcarbamimidothioate |
|---|---|
| PubChem CID | 143338690 |
| Molecular Formula | C14H19N5OS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | [2-[(2R)-2-methylpyrrolidin-1-yl]-2-oxoethyl] N-diazenyl-N-phenylcarbamimidothioate |
| SMILES | [H]/N=C(\SCC(=O)N1CCC[C@H]1C)N(/N=N/[H])c1ccccc1 |
| InChI | InChI=1S/C14H19N5OS/c1-11-6-5-9-18(11)13(20)10-21-14(15)19(17-16)12-7-3-2-4-8-12/h2-4,7-8,11,15-16H,5-6,9-10H2,1H3/b15-14-,17-16+/t11-/m1/s1 |
| InChIKey | AUNFFMSKHGZDIL-CYEXRSQUSA-N |
| XLogP | 3.12 |
| TPSA | 83.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|