C28H36N6O2 — CID 143340912
4-[2-[6-(4-methyl-5-penta-2,4-dienyl-1H-pyrrol-3-yl)-4-piperazin-1-ylquinazolin-2-yl]oxyethyl]morpholine (PubChem CID 143340912) has the molecular formula C28H36N6O2 and a molecular weight of 488.64 g/mol. Its IUPAC name is 4-[2-[6-(4-methyl-5-penta-2,4-dienyl-1H-pyrrol-3-yl)-4-piperazin-1-ylquinazolin-2-yl]oxyethyl]morpholine.
| Compound Name | 4-[2-[6-(4-methyl-5-penta-2,4-dienyl-1H-pyrrol-3-yl)-4-piperazin-1-ylquinazolin-2-yl]oxyethyl]morpholine |
|---|---|
| PubChem CID | 143340912 |
| Molecular Formula | C28H36N6O2 |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | 4-[2-[6-(4-methyl-5-penta-2,4-dienyl-1H-pyrrol-3-yl)-4-piperazin-1-ylquinazolin-2-yl]oxyethyl]morpholine |
| SMILES | C=CC=CCc1[nH]cc(-c2ccc3nc(OCCN4CCOCC4)nc(N4CCNCC4)c3c2)c1C |
| InChI | InChI=1S/C28H36N6O2/c1-3-4-5-6-25-21(2)24(20-30-25)22-7-8-26-23(19-22)27(34-11-9-29-10-12-34)32-28(31-26)36-18-15-33-13-16-35-17-14-33/h3-5,7-8,19-20,29-30H,1,6,9-18H2,2H3 |
| InChIKey | FDGQNUHPJKCIHL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 78.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|