C16H37NS — CID 143342053
ethane;4-ethenylsulfanyl-N,5-dimethylhex-4-en-3-amine (PubChem CID 143342053) has the molecular formula C16H37NS and a molecular weight of 275.55 g/mol. Its IUPAC name is ethane;4-ethenylsulfanyl-N,5-dimethylhex-4-en-3-amine.
| Compound Name | ethane;4-ethenylsulfanyl-N,5-dimethylhex-4-en-3-amine |
|---|---|
| PubChem CID | 143342053 |
| Molecular Formula | C16H37NS |
| Molecular Weight | 275.55 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | ethane;4-ethenylsulfanyl-N,5-dimethylhex-4-en-3-amine |
| SMILES | C=CSC(=C(C)C)C(CC)NC.CC.CC.CC |
| InChI | InChI=1S/C10H19NS.3C2H6/c1-6-9(11-5)10(8(3)4)12-7-2;3*1-2/h7,9,11H,2,6H2,1,3-5H3;3*1-2H3 |
| InChIKey | RPBRGKCQKHVNPA-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.55 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |