C9H17NS — CID 163682439
3-ethenylsulfanyl-N,4-dimethylpent-3-en-1-amine (PubChem CID 163682439) has the molecular formula C9H17NS and a molecular weight of 171.31 g/mol. Its IUPAC name is 3-ethenylsulfanyl-N,4-dimethylpent-3-en-1-amine.
| Compound Name | 3-ethenylsulfanyl-N,4-dimethylpent-3-en-1-amine |
|---|---|
| PubChem CID | 163682439 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 3-ethenylsulfanyl-N,4-dimethylpent-3-en-1-amine |
| SMILES | C=CSC(CCNC)=C(C)C |
| InChI | InChI=1S/C9H17NS/c1-5-11-9(8(2)3)6-7-10-4/h5,10H,1,6-7H2,2-4H3 |
| InChIKey | JLYLVGHFFZGZCB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |