C11H15NO — CID 143342253
[4-(1-methoxyethenyl)cyclohepta-1,3,6-trien-1-yl]methanamine (PubChem CID 143342253) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is [4-(1-methoxyethenyl)cyclohepta-1,3,6-trien-1-yl]methanamine.
| Compound Name | [4-(1-methoxyethenyl)cyclohepta-1,3,6-trien-1-yl]methanamine |
|---|---|
| PubChem CID | 143342253 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | [4-(1-methoxyethenyl)cyclohepta-1,3,6-trien-1-yl]methanamine |
| SMILES | C=C(OC)C1=CC=C(CN)C=CC1 |
| InChI | InChI=1S/C11H15NO/c1-9(13-2)11-5-3-4-10(8-12)6-7-11/h3-4,6-7H,1,5,8,12H2,2H3 |
| InChIKey | ZJFZPTVXMVRWGG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|