C32H52N4 — CID 143342626
(3Z)-3-(dimethylamino)-5-ethenylimino-6-[[(2E,4E)-2-ethyl-4,5,8,8-tetramethyl-6-methylidenenona-2,4-dienyl]amino]-2,2-dimethylhepta-3,6-dienenitrile;prop-1-ene (PubChem CID 143342626) has the molecular formula C32H52N4 and a molecular weight of 492.80 g/mol. Its IUPAC name is (3Z)-3-(dimethylamino)-5-ethenylimino-6-[[(2E,4E)-2-ethyl-4,5,8,8-tetramethyl-6-methylidenenona-2,4-dienyl]amino]-2,2-dimethylhepta-3,6-dienenitrile;prop-1-ene.
| Compound Name | (3Z)-3-(dimethylamino)-5-ethenylimino-6-[[(2E,4E)-2-ethyl-4,5,8,8-tetramethyl-6-methylidenenona-2,4-dienyl]amino]-2,2-dimethylhepta-3,6-dienenitrile;prop-1-ene |
|---|---|
| PubChem CID | 143342626 |
| Molecular Formula | C32H52N4 |
| Molecular Weight | 492.80 g/mol |
| Exact Mass | 492.42 |
| IUPAC Name | (3Z)-3-(dimethylamino)-5-ethenylimino-6-[[(2E,4E)-2-ethyl-4,5,8,8-tetramethyl-6-methylidenenona-2,4-dienyl]amino]-2,2-dimethylhepta-3,6-dienenitrile;prop-1-ene |
| SMILES | C=C/N=C(/C=C(\N(C)C)C(C)(C)C#N)C(=C)NC/C(=C/C(C)=C(\C)C(=C)CC(C)(C)C)CC.C=CC |
| InChI | InChI=1S/C29H46N4.C3H6/c1-14-25(16-21(3)23(5)22(4)18-28(7,8)9)19-32-24(6)26(31-15-2)17-27(33(12)13)29(10,11)20-30;1-3-2/h15-17,32H,2,4,6,14,18-19H2,1,3,5,7-13H3;3H,1H2,2H3/b23-21+,25-16+,27-17-,31-26-; |
| InChIKey | RINNULSXIPCVRA-YHCDPTRFSA-N |
| XLogP | 8.53 |
| TPSA | 51.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.80 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|