C26H44N3+ — CID 145477159
[(3Z,5E,7E,10E)-7-amino-8-[[(E)-but-1-enyl]amino]-5-ethenyl-9,9,10-trimethyltrideca-3,5,7,10-tetraen-2-ylidene]-diethylazanium (PubChem CID 145477159) has the molecular formula C26H44N3+ and a molecular weight of 398.66 g/mol. Its IUPAC name is [(3Z,5E,7E,10E)-7-amino-8-[[(E)-but-1-enyl]amino]-5-ethenyl-9,9,10-trimethyltrideca-3,5,7,10-tetraen-2-ylidene]-diethylazanium.
| Compound Name | [(3Z,5E,7E,10E)-7-amino-8-[[(E)-but-1-enyl]amino]-5-ethenyl-9,9,10-trimethyltrideca-3,5,7,10-tetraen-2-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 145477159 |
| Molecular Formula | C26H44N3+ |
| Molecular Weight | 398.66 g/mol |
| Exact Mass | 398.35 |
| IUPAC Name | [(3Z,5E,7E,10E)-7-amino-8-[[(E)-but-1-enyl]amino]-5-ethenyl-9,9,10-trimethyltrideca-3,5,7,10-tetraen-2-ylidene]-diethylazanium |
| SMILES | C=CC(/C=C\C(C)=[N+](CC)CC)=C\C(N)=C(/N/C=C/CC)C(C)(C)/C(C)=C/CC |
| InChI | InChI=1S/C26H43N3/c1-10-15-19-28-25(26(8,9)21(6)16-11-2)24(27)20-23(12-3)18-17-22(7)29(13-4)14-5/h12,15-20H,3,10-11,13-14,27H2,1-2,4-9H3/p+1/b19-15+,21-16+ |
| InChIKey | BJBFGTGJWRZYHS-WIDTVHIISA-O |
| XLogP | 6.23 |
| TPSA | 41.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.66 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|