C30H46N4 — CID 143346547
(3Z,5E)-5,9,9-trimethyl-7-methylidene-N-[(3E)-3-[(E)-2-(methylideneamino)-1-[methyl(2-methylprop-2-enyl)amino]ethenyl]iminopenta-1,4-dien-2-yl]-3-[(Z)-prop-1-enyl]deca-3,5-dien-1-amine (PubChem CID 143346547) has the molecular formula C30H46N4 and a molecular weight of 462.73 g/mol. Its IUPAC name is (3Z,5E)-5,9,9-trimethyl-7-methylidene-N-[(3E)-3-[(E)-2-(methylideneamino)-1-[methyl(2-methylprop-2-enyl)amino]ethenyl]iminopenta-1,4-dien-2-yl]-3-[(Z)-prop-1-enyl]deca-3,5-dien-1-amine.
| Compound Name | (3Z,5E)-5,9,9-trimethyl-7-methylidene-N-[(3E)-3-[(E)-2-(methylideneamino)-1-[methyl(2-methylprop-2-enyl)amino]ethenyl]iminopenta-1,4-dien-2-yl]-3-[(Z)-prop-1-enyl]deca-3,5-dien-1-amine |
|---|---|
| PubChem CID | 143346547 |
| Molecular Formula | C30H46N4 |
| Molecular Weight | 462.73 g/mol |
| Exact Mass | 462.37 |
| IUPAC Name | (3Z,5E)-5,9,9-trimethyl-7-methylidene-N-[(3E)-3-[(E)-2-(methylideneamino)-1-[methyl(2-methylprop-2-enyl)amino]ethenyl]iminopenta-1,4-dien-2-yl]-3-[(Z)-prop-1-enyl]deca-3,5-dien-1-amine |
| SMILES | C=C/C(=N\C(=C\N=C)N(C)CC(=C)C)C(=C)NCCC(/C=C\C)=C/C(C)=C/C(=C)CC(C)(C)C |
| InChI | InChI=1S/C30H46N4/c1-13-15-27(19-24(5)18-25(6)20-30(8,9)10)16-17-32-26(7)28(14-2)33-29(21-31-11)34(12)22-23(3)4/h13-15,18-19,21,32H,2-3,6-7,11,16-17,20,22H2,1,4-5,8-10,12H3/b15-13-,24-18+,27-19+,29-21-,33-28+ |
| InChIKey | PLJILVVMGHYFSW-QVGYIHBYSA-N |
| XLogP | 7.56 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.73 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|