C26H40N6 — CID 176537252
(1Z)-1-N-[2-(butylamino)prop-2-enyl]-4-ethenyl-6-methyl-5-methylimino-2-[(1Z)-1-(1-methylpyrimidin-2-ylidene)prop-2-enyl]hepta-1,3-diene-1,3-diamine (PubChem CID 176537252) has the molecular formula C26H40N6 and a molecular weight of 436.65 g/mol. Its IUPAC name is (1Z)-1-N-[2-(butylamino)prop-2-enyl]-4-ethenyl-6-methyl-5-methylimino-2-[(1Z)-1-(1-methylpyrimidin-2-ylidene)prop-2-enyl]hepta-1,3-diene-1,3-diamine.
| Compound Name | (1Z)-1-N-[2-(butylamino)prop-2-enyl]-4-ethenyl-6-methyl-5-methylimino-2-[(1Z)-1-(1-methylpyrimidin-2-ylidene)prop-2-enyl]hepta-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 176537252 |
| Molecular Formula | C26H40N6 |
| Molecular Weight | 436.65 g/mol |
| Exact Mass | 436.33 |
| IUPAC Name | (1Z)-1-N-[2-(butylamino)prop-2-enyl]-4-ethenyl-6-methyl-5-methylimino-2-[(1Z)-1-(1-methylpyrimidin-2-ylidene)prop-2-enyl]hepta-1,3-diene-1,3-diamine |
| SMILES | C=CC(=C(N)C(=C\NCC(=C)NCCCC)/C(C=C)=C1\N=CC=CN1C)/C(=N/C)C(C)C |
| InChI | InChI=1S/C26H40N6/c1-9-12-14-30-20(6)17-29-18-23(21(10-2)26-31-15-13-16-32(26)8)24(27)22(11-3)25(28-7)19(4)5/h10-11,13,15-16,18-19,29-30H,2-3,6,9,12,14,17,27H2,1,4-5,7-8H3/b23-18-,24-22?,26-21+,28-25+ |
| InChIKey | PDAGZKWJNCOFTO-AEEWZFKESA-N |
| XLogP | 4.42 |
| TPSA | 78.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.65 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|