C26H36N2 — CID 167122056
4-cyclohexa-1,5-dien-1-yl-2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6-[(E)-5-methyloct-4-en-2-yl]-1,2-dihydropyrimidine (PubChem CID 167122056) has the molecular formula C26H36N2 and a molecular weight of 376.59 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yl-2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6-[(E)-5-methyloct-4-en-2-yl]-1,2-dihydropyrimidine.
| Compound Name | 4-cyclohexa-1,5-dien-1-yl-2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6-[(E)-5-methyloct-4-en-2-yl]-1,2-dihydropyrimidine |
|---|---|
| PubChem CID | 167122056 |
| Molecular Formula | C26H36N2 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.29 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yl-2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6-[(E)-5-methyloct-4-en-2-yl]-1,2-dihydropyrimidine |
| SMILES | C=C/C=C\C(=C/C)C1N=C(C2=CCCC=C2)C=C(C(C)C/C=C(\C)CCC)N1 |
| InChI | InChI=1S/C26H36N2/c1-6-9-14-22(8-3)26-27-24(21(5)18-17-20(4)13-7-2)19-25(28-26)23-15-11-10-12-16-23/h6,8-9,11,14-17,19,21,26-27H,1,7,10,12-13,18H2,2-5H3/b14-9-,20-17+,22-8+ |
| InChIKey | ZJMAERQQZZRSAZ-OOUQRMAZSA-N |
| XLogP | 6.98 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|