C29H47N5 — CID 143342947
N,4-bis(ethenyl)-1-methyl-6-(2-methylprop-2-enyl)pyrimidin-2-imine;ethene;(2E,4Z)-2-ethyl-1-N,4-N,4-N,5-tetramethylocta-2,4,7-triene-1,4-diamine (PubChem CID 143342947) has the molecular formula C29H47N5 and a molecular weight of 465.73 g/mol. Its IUPAC name is N,4-bis(ethenyl)-1-methyl-6-(2-methylprop-2-enyl)pyrimidin-2-imine;ethene;(2E,4Z)-2-ethyl-1-N,4-N,4-N,5-tetramethylocta-2,4,7-triene-1,4-diamine.
| Compound Name | N,4-bis(ethenyl)-1-methyl-6-(2-methylprop-2-enyl)pyrimidin-2-imine;ethene;(2E,4Z)-2-ethyl-1-N,4-N,4-N,5-tetramethylocta-2,4,7-triene-1,4-diamine |
|---|---|
| PubChem CID | 143342947 |
| Molecular Formula | C29H47N5 |
| Molecular Weight | 465.73 g/mol |
| Exact Mass | 465.38 |
| IUPAC Name | N,4-bis(ethenyl)-1-methyl-6-(2-methylprop-2-enyl)pyrimidin-2-imine;ethene;(2E,4Z)-2-ethyl-1-N,4-N,4-N,5-tetramethylocta-2,4,7-triene-1,4-diamine |
| SMILES | C=C.C=C/N=c1\nc(C=C)cc(CC(=C)C)n1C.C=CC/C(C)=C(/C=C(\CC)CNC)N(C)C |
| InChI | InChI=1S/C14H26N2.C13H17N3.C2H4/c1-7-9-12(3)14(16(5)6)10-13(8-2)11-15-4;1-6-11-9-12(8-10(3)4)16(5)13(15-11)14-7-2;1-2/h7,10,15H,1,8-9,11H2,2-6H3;6-7,9H,1-3,8H2,4-5H3;1-2H2/b13-10+,14-12-;14-13+; |
| InChIKey | NJSNPYMRFQDEPT-FYAVYUEGSA-N |
| XLogP | 5.98 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.73 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|