C14H19N3 — CID 143345879
acetylene;(E)-(6-but-1-en-2-yl-4-ethenyl-1-methylpyrimidin-2-ylidene)methanamine (PubChem CID 143345879) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is acetylene;(E)-(6-but-1-en-2-yl-4-ethenyl-1-methylpyrimidin-2-ylidene)methanamine.
| Compound Name | acetylene;(E)-(6-but-1-en-2-yl-4-ethenyl-1-methylpyrimidin-2-ylidene)methanamine |
|---|---|
| PubChem CID | 143345879 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | acetylene;(E)-(6-but-1-en-2-yl-4-ethenyl-1-methylpyrimidin-2-ylidene)methanamine |
| SMILES | C#C.C=CC1=N/C(=C/N)N(C)C(C(=C)CC)=C1 |
| InChI | InChI=1S/C12H17N3.C2H2/c1-5-9(3)11-7-10(6-2)14-12(8-13)15(11)4;1-2/h6-8H,2-3,5,13H2,1,4H3;1-2H/b12-8-; |
| InChIKey | LEQHCZIOVIJGCK-JCTPKUEWSA-N |
| XLogP | 2.42 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|