C14H18N2 — CID 143343107
(2E)-6-but-1-en-2-yl-4-ethenyl-1-methyl-2-prop-2-enylidenepyrimidine (PubChem CID 143343107) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is (2E)-6-but-1-en-2-yl-4-ethenyl-1-methyl-2-prop-2-enylidenepyrimidine.
| Compound Name | (2E)-6-but-1-en-2-yl-4-ethenyl-1-methyl-2-prop-2-enylidenepyrimidine |
|---|---|
| PubChem CID | 143343107 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | (2E)-6-but-1-en-2-yl-4-ethenyl-1-methyl-2-prop-2-enylidenepyrimidine |
| SMILES | C=C/C=C1/N=C(C=C)C=C(C(=C)CC)N1C |
| InChI | InChI=1S/C14H18N2/c1-6-9-14-15-12(8-3)10-13(16(14)5)11(4)7-2/h6,8-10H,1,3-4,7H2,2,5H3/b14-9- |
| InChIKey | FSKPEWBUVZJYAN-ZROIWOOFSA-N |
| XLogP | 3.44 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |