C18H30N2 — CID 143345365
acetylene;6-but-1-en-2-yl-4-ethenyl-1-methyl-2-methylidenepyrimidine;ethane (PubChem CID 143345365) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is acetylene;6-but-1-en-2-yl-4-ethenyl-1-methyl-2-methylidenepyrimidine;ethane.
| Compound Name | acetylene;6-but-1-en-2-yl-4-ethenyl-1-methyl-2-methylidenepyrimidine;ethane |
|---|---|
| PubChem CID | 143345365 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | acetylene;6-but-1-en-2-yl-4-ethenyl-1-methyl-2-methylidenepyrimidine;ethane |
| SMILES | C#C.C=CC1=NC(=C)N(C)C(C(=C)CC)=C1.CC.CC |
| InChI | InChI=1S/C12H16N2.2C2H6.C2H2/c1-6-9(3)12-8-11(7-2)13-10(4)14(12)5;3*1-2/h7-8H,2-4,6H2,1,5H3;2*1-2H3;1-2H |
| InChIKey | KZPNRSSHEJBXRQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|