C17H27N3 — CID 143345847
4-but-1-en-2-yl-2-ethenyl-6H-pyrazino[1,2-a]pyrimidine;ethane (PubChem CID 143345847) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is 4-but-1-en-2-yl-2-ethenyl-6H-pyrazino[1,2-a]pyrimidine;ethane.
| Compound Name | 4-but-1-en-2-yl-2-ethenyl-6H-pyrazino[1,2-a]pyrimidine;ethane |
|---|---|
| PubChem CID | 143345847 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | 4-but-1-en-2-yl-2-ethenyl-6H-pyrazino[1,2-a]pyrimidine;ethane |
| SMILES | C=CC1=NC2=CN=CCN2C(C(=C)CC)=C1.CC.CC |
| InChI | InChI=1S/C13H15N3.2C2H6/c1-4-10(3)12-8-11(5-2)15-13-9-14-6-7-16(12)13;2*1-2/h5-6,8-9H,2-4,7H2,1H3;2*1-2H3 |
| InChIKey | GYSYSFOGGZCVNB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |