C15H23N3 — CID 143343106
(2E)-6-but-1-en-2-yl-4-ethenyl-1-methyl-2-prop-2-enylidenepyrimidine;methanamine (PubChem CID 143343106) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is (2E)-6-but-1-en-2-yl-4-ethenyl-1-methyl-2-prop-2-enylidenepyrimidine;methanamine.
| Compound Name | (2E)-6-but-1-en-2-yl-4-ethenyl-1-methyl-2-prop-2-enylidenepyrimidine;methanamine |
|---|---|
| PubChem CID | 143343106 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | (2E)-6-but-1-en-2-yl-4-ethenyl-1-methyl-2-prop-2-enylidenepyrimidine;methanamine |
| SMILES | C=C/C=C1/N=C(C=C)C=C(C(=C)CC)N1C.CN |
| InChI | InChI=1S/C14H18N2.CH5N/c1-6-9-14-15-12(8-3)10-13(16(14)5)11(4)7-2;1-2/h6,8-10H,1,3-4,7H2,2,5H3;2H2,1H3/b14-9-; |
| InChIKey | ASJBBNZBFXXGDJ-WQRRWHLMSA-N |
| XLogP | 3.01 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |