C12H21N3 — CID 155728081
1-N'-[(Z,2Z)-5-methylimino-2-propylidenehex-3-enyl]ethene-1,1-diamine (PubChem CID 155728081) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 1-N'-[(Z,2Z)-5-methylimino-2-propylidenehex-3-enyl]ethene-1,1-diamine.
| Compound Name | 1-N'-[(Z,2Z)-5-methylimino-2-propylidenehex-3-enyl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 155728081 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 1-N'-[(Z,2Z)-5-methylimino-2-propylidenehex-3-enyl]ethene-1,1-diamine |
| SMILES | C=C(N)NCC(/C=C\C(C)=N\C)=C\CC |
| InChI | InChI=1S/C12H21N3/c1-5-6-12(9-15-11(3)13)8-7-10(2)14-4/h6-8,15H,3,5,9,13H2,1-2,4H3/b8-7-,12-6-,14-10+ |
| InChIKey | DZYPFBOUEKDXTG-MLSDAXRQSA-N |
| XLogP | 1.99 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|