C10H19N3 — CID 123568221
N'-(5-methylidene-2-methyliminohept-3-enyl)methanediamine (PubChem CID 123568221) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is N'-(5-methylidene-2-methyliminohept-3-enyl)methanediamine.
| Compound Name | N'-(5-methylidene-2-methyliminohept-3-enyl)methanediamine |
|---|---|
| PubChem CID | 123568221 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | N'-(5-methylidene-2-methyliminohept-3-enyl)methanediamine |
| SMILES | C=C(C=C/C(CNCN)=N/C)CC |
| InChI | InChI=1S/C10H19N3/c1-4-9(2)5-6-10(12-3)7-13-8-11/h5-6,13H,2,4,7-8,11H2,1,3H3/b6-5?,12-10- |
| InChIKey | SHXSZZFATJKDEQ-DQNMIAARSA-N |
| XLogP | 1.09 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|