C17H25NO3 — CID 143344526
tert-butyl N-(5-formyl-6-methyl-1,2,3,5,6,7-hexahydroazulen-1-yl)carbamate (PubChem CID 143344526) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is tert-butyl N-(5-formyl-6-methyl-1,2,3,5,6,7-hexahydroazulen-1-yl)carbamate.
| Compound Name | tert-butyl N-(5-formyl-6-methyl-1,2,3,5,6,7-hexahydroazulen-1-yl)carbamate |
|---|---|
| PubChem CID | 143344526 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | tert-butyl N-(5-formyl-6-methyl-1,2,3,5,6,7-hexahydroazulen-1-yl)carbamate |
| SMILES | CC1CC=C2C(=CC1C=O)CCC2NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H25NO3/c1-11-5-7-14-12(9-13(11)10-19)6-8-15(14)18-16(20)21-17(2,3)4/h7,9-11,13,15H,5-6,8H2,1-4H3,(H,18,20) |
| InChIKey | OSSVKWODABGKGQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|