C12H22F3N — CID 143344970
ethane;N-methylpent-1-en-3-imine;(E)-1,1,1-trifluorobut-2-ene (PubChem CID 143344970) has the molecular formula C12H22F3N and a molecular weight of 237.31 g/mol. Its IUPAC name is ethane;N-methylpent-1-en-3-imine;(E)-1,1,1-trifluorobut-2-ene.
| Compound Name | ethane;N-methylpent-1-en-3-imine;(E)-1,1,1-trifluorobut-2-ene |
|---|---|
| PubChem CID | 143344970 |
| Molecular Formula | C12H22F3N |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | ethane;N-methylpent-1-en-3-imine;(E)-1,1,1-trifluorobut-2-ene |
| SMILES | C/C=C/C(F)(F)F.C=C/C(CC)=N\C.CC |
| InChI | InChI=1S/C6H11N.C4H5F3.C2H6/c1-4-6(5-2)7-3;1-2-3-4(5,6)7;1-2/h4H,1,5H2,2-3H3;2-3H,1H3;1-2H3/b7-6+;3-2+; |
| InChIKey | PFKIXSDDNNNKST-DQEMQKKISA-N |
| XLogP | 4.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|