C11H20N2O5S — CID 14334556
methyl 2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]acetate (PubChem CID 14334556) has the molecular formula C11H20N2O5S and a molecular weight of 292.36 g/mol. Its IUPAC name is methyl 2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]acetate.
| Compound Name | methyl 2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]acetate |
|---|---|
| PubChem CID | 14334556 |
| Molecular Formula | C11H20N2O5S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | methyl 2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)[C@H](CS)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H20N2O5S/c1-11(2,3)18-10(16)13-7(6-19)9(15)12-5-8(14)17-4/h7,19H,5-6H2,1-4H3,(H,12,15)(H,13,16)/t7-/m0/s1 |
| InChIKey | UEWUYRCICTUPSQ-ZETCQYMHSA-N |
| XLogP | 0.10 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|