C10H19N3O — CID 143346929
2-cyclohexyl-5-methyl-1,3,4-oxadiazole;methanamine (PubChem CID 143346929) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-cyclohexyl-5-methyl-1,3,4-oxadiazole;methanamine.
| Compound Name | 2-cyclohexyl-5-methyl-1,3,4-oxadiazole;methanamine |
|---|---|
| PubChem CID | 143346929 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 2-cyclohexyl-5-methyl-1,3,4-oxadiazole;methanamine |
| SMILES | CN.Cc1nnc(C2CCCCC2)o1 |
| InChI | InChI=1S/C9H14N2O.CH5N/c1-7-10-11-9(12-7)8-5-3-2-4-6-8;1-2/h8H,2-6H2,1H3;2H2,1H3 |
| InChIKey | LHUZEIGEVVQNOI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |