C11H18F2N2O — CID 153404817
2-cyclohexyl-5-(difluoromethyl)-1,3,4-oxadiazole;ethane (PubChem CID 153404817) has the molecular formula C11H18F2N2O and a molecular weight of 232.27 g/mol. Its IUPAC name is 2-cyclohexyl-5-(difluoromethyl)-1,3,4-oxadiazole;ethane.
| Compound Name | 2-cyclohexyl-5-(difluoromethyl)-1,3,4-oxadiazole;ethane |
|---|---|
| PubChem CID | 153404817 |
| Molecular Formula | C11H18F2N2O |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 2-cyclohexyl-5-(difluoromethyl)-1,3,4-oxadiazole;ethane |
| SMILES | CC.FC(F)c1nnc(C2CCCCC2)o1 |
| InChI | InChI=1S/C9H12F2N2O.C2H6/c10-7(11)9-13-12-8(14-9)6-4-2-1-3-5-6;1-2/h6-7H,1-5H2;1-2H3 |
| InChIKey | ZJDRANXGFNJUAF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |