C10H15BrN2O — CID 62856349
2-(1-bromopropyl)-5-cyclopentyl-1,3,4-oxadiazole (PubChem CID 62856349) has the molecular formula C10H15BrN2O and a molecular weight of 259.15 g/mol. Its IUPAC name is 2-(1-bromopropyl)-5-cyclopentyl-1,3,4-oxadiazole.
| Compound Name | 2-(1-bromopropyl)-5-cyclopentyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 62856349 |
| Molecular Formula | C10H15BrN2O |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 2-(1-bromopropyl)-5-cyclopentyl-1,3,4-oxadiazole |
| SMILES | CCC(Br)c1nnc(C2CCCC2)o1 |
| InChI | InChI=1S/C10H15BrN2O/c1-2-8(11)10-13-12-9(14-10)7-5-3-4-6-7/h7-8H,2-6H2,1H3 |
| InChIKey | MBISBZKEACBBST-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|