C8H13N3O — CID 62072169
1-(5-cyclobutyl-1,3,4-oxadiazol-2-yl)ethanamine (PubChem CID 62072169) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 1-(5-cyclobutyl-1,3,4-oxadiazol-2-yl)ethanamine.
| Compound Name | 1-(5-cyclobutyl-1,3,4-oxadiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 62072169 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 1-(5-cyclobutyl-1,3,4-oxadiazol-2-yl)ethanamine |
| SMILES | CC(N)c1nnc(C2CCC2)o1 |
| InChI | InChI=1S/C8H13N3O/c1-5(9)7-10-11-8(12-7)6-3-2-4-6/h5-6H,2-4,9H2,1H3 |
| InChIKey | GQIIXVCOTOMNGG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |